C20H17IN8O2S — CID 163594768
7-ethyl-3-[(4-iodophenyl)methyl]-8-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)purine-2,6-dione (PubChem CID 163594768) has the molecular formula C20H17IN8O2S and a molecular weight of 560.38 g/mol. Its IUPAC name is 7-ethyl-3-[(4-iodophenyl)methyl]-8-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)purine-2,6-dione.
| Compound Name | 7-ethyl-3-[(4-iodophenyl)methyl]-8-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 163594768 |
| Molecular Formula | C20H17IN8O2S |
| Molecular Weight | 560.38 g/mol |
| Exact Mass | 560.02 |
| IUPAC Name | 7-ethyl-3-[(4-iodophenyl)methyl]-8-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)purine-2,6-dione |
| SMILES | CCn1c(CSc2nc3ncccn3n2)nc2c1c(=O)[nH]c(=O)n2Cc1ccc(I)cc1 |
| InChI | InChI=1S/C20H17IN8O2S/c1-2-27-14(11-32-19-25-18-22-8-3-9-29(18)26-19)23-16-15(27)17(30)24-20(31)28(16)10-12-4-6-13(21)7-5-12/h3-9H,2,10-11H2,1H3,(H,24,30,31) |
| InChIKey | GSMMPHUQXUEPOX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|