C18H36NO5P — CID 139525382
N-[2-methyl-4-(2-methyl-6-oxohexan-2-yl)oxybutan-2-yl]-2-[methyl(2-methylperoxyethyl)phosphanyl]acetamide (PubChem CID 139525382) has the molecular formula C18H36NO5P and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[2-methyl-4-(2-methyl-6-oxohexan-2-yl)oxybutan-2-yl]-2-[methyl(2-methylperoxyethyl)phosphanyl]acetamide.
| Compound Name | N-[2-methyl-4-(2-methyl-6-oxohexan-2-yl)oxybutan-2-yl]-2-[methyl(2-methylperoxyethyl)phosphanyl]acetamide |
|---|---|
| PubChem CID | 139525382 |
| Molecular Formula | C18H36NO5P |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | N-[2-methyl-4-(2-methyl-6-oxohexan-2-yl)oxybutan-2-yl]-2-[methyl(2-methylperoxyethyl)phosphanyl]acetamide |
| SMILES | COOCCP(C)CC(=O)NC(C)(C)CCOC(C)(C)CCCC=O |
| InChI | InChI=1S/C18H36NO5P/c1-17(2,10-12-23-18(3,4)9-7-8-11-20)19-16(21)15-25(6)14-13-24-22-5/h11H,7-10,12-15H2,1-6H3,(H,19,21) |
| InChIKey | PTPYKNFFUSIRKP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|