C31H39ClF2N2O3 — CID 139530208
methyl 4-[(5R,6S)-8a-[4-(3-tert-butyl-2,2-difluorocyclopropyl)-3-chlorophenyl]-5,6-dimethyl-2-oxo-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]bicyclo[2.1.1]hexane-1-carboxylate (PubChem CID 139530208) has the molecular formula C31H39ClF2N2O3 and a molecular weight of 561.11 g/mol. Its IUPAC name is methyl 4-[(5R,6S)-8a-[4-(3-tert-butyl-2,2-difluorocyclopropyl)-3-chlorophenyl]-5,6-dimethyl-2-oxo-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]bicyclo[2.1.1]hexane-1-carboxylate.
| Compound Name | methyl 4-[(5R,6S)-8a-[4-(3-tert-butyl-2,2-difluorocyclopropyl)-3-chlorophenyl]-5,6-dimethyl-2-oxo-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]bicyclo[2.1.1]hexane-1-carboxylate |
|---|---|
| PubChem CID | 139530208 |
| Molecular Formula | C31H39ClF2N2O3 |
| Molecular Weight | 561.11 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | methyl 4-[(5R,6S)-8a-[4-(3-tert-butyl-2,2-difluorocyclopropyl)-3-chlorophenyl]-5,6-dimethyl-2-oxo-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]bicyclo[2.1.1]hexane-1-carboxylate |
| SMILES | COC(=O)C12CCC(N3C=C4[C@H](C)[C@@H](C)CCC4(c4ccc(C5C(C(C)(C)C)C5(F)F)c(Cl)c4)NC3=O)(C1)C2 |
| InChI | InChI=1S/C31H39ClF2N2O3/c1-17-9-10-30(19-7-8-20(22(32)13-19)23-24(27(3,4)5)31(23,33)34)21(18(17)2)14-36(26(38)35-30)29-12-11-28(15-29,16-29)25(37)39-6/h7-8,13-14,17-18,23-24H,9-12,15-16H2,1-6H3,(H,35,38)/t17-,18+,23?,24?,28?,29?,30?/m0/s1 |
| InChIKey | BTDWASBJXQTXSQ-TUAMBKJLSA-N |
| XLogP | 7.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.11 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |