C23H31ClF2O — CID 159123252
(4R,5S)-7a-[4-(3-tert-butyl-2,2-difluorocyclopropyl)-3-chlorophenyl]-4,5-dimethyl-3,3a,4,5,6,7-hexahydro-1H-2-benzofuran (PubChem CID 159123252) has the molecular formula C23H31ClF2O and a molecular weight of 396.95 g/mol. Its IUPAC name is (4R,5S)-7a-[4-(3-tert-butyl-2,2-difluorocyclopropyl)-3-chlorophenyl]-4,5-dimethyl-3,3a,4,5,6,7-hexahydro-1H-2-benzofuran.
| Compound Name | (4R,5S)-7a-[4-(3-tert-butyl-2,2-difluorocyclopropyl)-3-chlorophenyl]-4,5-dimethyl-3,3a,4,5,6,7-hexahydro-1H-2-benzofuran |
|---|---|
| PubChem CID | 159123252 |
| Molecular Formula | C23H31ClF2O |
| Molecular Weight | 396.95 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (4R,5S)-7a-[4-(3-tert-butyl-2,2-difluorocyclopropyl)-3-chlorophenyl]-4,5-dimethyl-3,3a,4,5,6,7-hexahydro-1H-2-benzofuran |
| SMILES | C[C@H]1CCC2(c3ccc(C4C(C(C)(C)C)C4(F)F)c(Cl)c3)COCC2[C@@H]1C |
| InChI | InChI=1S/C23H31ClF2O/c1-13-8-9-22(12-27-11-17(22)14(13)2)15-6-7-16(18(24)10-15)19-20(21(3,4)5)23(19,25)26/h6-7,10,13-14,17,19-20H,8-9,11-12H2,1-5H3/t13-,14+,17?,19?,20?,22?/m0/s1 |
| InChIKey | DHWPNSKUZIGTTP-GPGVLLQKSA-N |
| XLogP | 6.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.95 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |