C11H10N2O5S — CID 139531882
3-(2,3-dimethoxythieno[2,3-b]pyrazin-6-yl)-3-oxopropanoic acid (PubChem CID 139531882) has the molecular formula C11H10N2O5S and a molecular weight of 282.28 g/mol. Its IUPAC name is 3-(2,3-dimethoxythieno[2,3-b]pyrazin-6-yl)-3-oxopropanoic acid.
| Compound Name | 3-(2,3-dimethoxythieno[2,3-b]pyrazin-6-yl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 139531882 |
| Molecular Formula | C11H10N2O5S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-(2,3-dimethoxythieno[2,3-b]pyrazin-6-yl)-3-oxopropanoic acid |
| SMILES | COc1nc2cc(C(=O)CC(=O)O)sc2nc1OC |
| InChI | InChI=1S/C11H10N2O5S/c1-17-9-10(18-2)13-11-5(12-9)3-7(19-11)6(14)4-8(15)16/h3H,4H2,1-2H3,(H,15,16) |
| InChIKey | HLXIFPCSHVYGRC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|