C13H13NO5S — CID 139559581
methyl 3-(5,6-dimethoxythieno[2,3-b]pyridin-2-yl)-3-oxopropanoate (PubChem CID 139559581) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is methyl 3-(5,6-dimethoxythieno[2,3-b]pyridin-2-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(5,6-dimethoxythieno[2,3-b]pyridin-2-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 139559581 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | methyl 3-(5,6-dimethoxythieno[2,3-b]pyridin-2-yl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1cc2cc(OC)c(OC)nc2s1 |
| InChI | InChI=1S/C13H13NO5S/c1-17-9-4-7-5-10(8(15)6-11(16)18-2)20-13(7)14-12(9)19-3/h4-5H,6H2,1-3H3 |
| InChIKey | OSJCVURAGFNHRR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|