C13H12N2O7S — CID 139559650
2-(2,3-dimethoxythieno[2,3-b]pyrazine-6-carbonyl)butanedioic acid (PubChem CID 139559650) has the molecular formula C13H12N2O7S and a molecular weight of 340.31 g/mol. Its IUPAC name is 2-(2,3-dimethoxythieno[2,3-b]pyrazine-6-carbonyl)butanedioic acid.
| Compound Name | 2-(2,3-dimethoxythieno[2,3-b]pyrazine-6-carbonyl)butanedioic acid |
|---|---|
| PubChem CID | 139559650 |
| Molecular Formula | C13H12N2O7S |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-(2,3-dimethoxythieno[2,3-b]pyrazine-6-carbonyl)butanedioic acid |
| SMILES | COc1nc2cc(C(=O)C(CC(=O)O)C(=O)O)sc2nc1OC |
| InChI | InChI=1S/C13H12N2O7S/c1-21-10-11(22-2)15-12-6(14-10)4-7(23-12)9(18)5(13(19)20)3-8(16)17/h4-5H,3H2,1-2H3,(H,16,17)(H,19,20) |
| InChIKey | SYYIZHBCMYBYQZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 135.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|