C25H33N7O — CID 139535406
1-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]-3-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]urea (PubChem CID 139535406) has the molecular formula C25H33N7O and a molecular weight of 447.59 g/mol. Its IUPAC name is 1-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]-3-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]urea.
| Compound Name | 1-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]-3-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 139535406 |
| Molecular Formula | C25H33N7O |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 1-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]-3-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]urea |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)NC3(c4ccnc(C#N)n4)CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C25H33N7O/c1-31(2)20-11-16-32(17-12-20)21-8-6-19(7-9-21)28-24(33)30-25(13-4-3-5-14-25)22-10-15-27-23(18-26)29-22/h6-10,15,20H,3-5,11-14,16-17H2,1-2H3,(H2,28,30,33) |
| InChIKey | JCSIBTUEFJIBFI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|