C18H15F4N5O — CID 151422028
1-[1-(2-cyanopyrimidin-4-yl)cyclopentyl]-3-[5-fluoro-2-(trifluoromethyl)phenyl]urea (PubChem CID 151422028) has the molecular formula C18H15F4N5O and a molecular weight of 393.34 g/mol. Its IUPAC name is 1-[1-(2-cyanopyrimidin-4-yl)cyclopentyl]-3-[5-fluoro-2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[1-(2-cyanopyrimidin-4-yl)cyclopentyl]-3-[5-fluoro-2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 151422028 |
| Molecular Formula | C18H15F4N5O |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-[1-(2-cyanopyrimidin-4-yl)cyclopentyl]-3-[5-fluoro-2-(trifluoromethyl)phenyl]urea |
| SMILES | N#Cc1nccc(C2(NC(=O)Nc3cc(F)ccc3C(F)(F)F)CCCC2)n1 |
| InChI | InChI=1S/C18H15F4N5O/c19-11-3-4-12(18(20,21)22)13(9-11)25-16(28)27-17(6-1-2-7-17)14-5-8-24-15(10-23)26-14/h3-5,8-9H,1-2,6-7H2,(H2,25,27,28) |
| InChIKey | PASWFRZNPGKTIA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |