C19H19FN4O2 — CID 153348294
(4-fluorophenyl)methyl N-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]carbamate (PubChem CID 153348294) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is (4-fluorophenyl)methyl N-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]carbamate.
| Compound Name | (4-fluorophenyl)methyl N-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 153348294 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (4-fluorophenyl)methyl N-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]carbamate |
| SMILES | N#Cc1nccc(C2(NC(=O)OCc3ccc(F)cc3)CCCCC2)n1 |
| InChI | InChI=1S/C19H19FN4O2/c20-15-6-4-14(5-7-15)13-26-18(25)24-19(9-2-1-3-10-19)16-8-11-22-17(12-21)23-16/h4-8,11H,1-3,9-10,13H2,(H,24,25) |
| InChIKey | OQJPZFQSAPUCEM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |