C26H34N6O — CID 151045981
1-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]-3-[4-(4-propan-2-ylpiperidin-1-yl)phenyl]urea (PubChem CID 151045981) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is 1-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]-3-[4-(4-propan-2-ylpiperidin-1-yl)phenyl]urea.
| Compound Name | 1-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]-3-[4-(4-propan-2-ylpiperidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 151045981 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 1-[1-(2-cyanopyrimidin-4-yl)cyclohexyl]-3-[4-(4-propan-2-ylpiperidin-1-yl)phenyl]urea |
| SMILES | CC(C)C1CCN(c2ccc(NC(=O)NC3(c4ccnc(C#N)n4)CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C26H34N6O/c1-19(2)20-11-16-32(17-12-20)22-8-6-21(7-9-22)29-25(33)31-26(13-4-3-5-14-26)23-10-15-28-24(18-27)30-23/h6-10,15,19-20H,3-5,11-14,16-17H2,1-2H3,(H2,29,31,33) |
| InChIKey | MDCBDJXKOPVBJQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|