C26H25F3N6O3S — CID 174224932
2-cyano-4-[1-[[4-[4-[(sulfinoamino)methyl]phenyl]-3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl]pyrimidine (PubChem CID 174224932) has the molecular formula C26H25F3N6O3S and a molecular weight of 558.59 g/mol. Its IUPAC name is 2-cyano-4-[1-[[4-[4-[(sulfinoamino)methyl]phenyl]-3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl]pyrimidine.
| Compound Name | 2-cyano-4-[1-[[4-[4-[(sulfinoamino)methyl]phenyl]-3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl]pyrimidine |
|---|---|
| PubChem CID | 174224932 |
| Molecular Formula | C26H25F3N6O3S |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 2-cyano-4-[1-[[4-[4-[(sulfinoamino)methyl]phenyl]-3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl]pyrimidine |
| SMILES | N#Cc1nccc(C2(NC(=O)Nc3ccc(-c4ccc(CNS(=O)O)cc4)c(C(F)(F)F)c3)CCCCC2)n1 |
| InChI | InChI=1S/C26H25F3N6O3S/c27-26(28,29)21-14-19(8-9-20(21)18-6-4-17(5-7-18)16-32-39(37)38)33-24(36)35-25(11-2-1-3-12-25)22-10-13-31-23(15-30)34-22/h4-10,13-14,32H,1-3,11-12,16H2,(H,37,38)(H2,33,35,36) |
| InChIKey | DTGUVULLNNSHPT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|