C20H11ClF4N4O — CID 87279969
1-[4-(2-chloro-3-cyano-4-pyridinyl)phenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea (PubChem CID 87279969) has the molecular formula C20H11ClF4N4O and a molecular weight of 434.78 g/mol. Its IUPAC name is 1-[4-(2-chloro-3-cyano-4-pyridinyl)phenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(2-chloro-3-cyano-4-pyridinyl)phenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 87279969 |
| Molecular Formula | C20H11ClF4N4O |
| Molecular Weight | 434.78 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 1-[4-(2-chloro-3-cyano-4-pyridinyl)phenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea |
| SMILES | N#Cc1c(-c2ccc(NC(=O)Nc3ccc(F)c(C(F)(F)F)c3)cc2)ccnc1Cl |
| InChI | InChI=1S/C20H11ClF4N4O/c21-18-15(10-26)14(7-8-27-18)11-1-3-12(4-2-11)28-19(30)29-13-5-6-17(22)16(9-13)20(23,24)25/h1-9H,(H2,28,29,30) |
| InChIKey | OLQGFGLATDAJPX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.78 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|