C26H25FNO6P — CID 139543439
[4-bis(phenylmethoxy)phosphoryloxy-3-fluorophenyl]methyl 2,3-dihydropyrrole-1-carboxylate (PubChem CID 139543439) has the molecular formula C26H25FNO6P and a molecular weight of 497.46 g/mol. Its IUPAC name is [4-bis(phenylmethoxy)phosphoryloxy-3-fluorophenyl]methyl 2,3-dihydropyrrole-1-carboxylate.
| Compound Name | [4-bis(phenylmethoxy)phosphoryloxy-3-fluorophenyl]methyl 2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 139543439 |
| Molecular Formula | C26H25FNO6P |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [4-bis(phenylmethoxy)phosphoryloxy-3-fluorophenyl]methyl 2,3-dihydropyrrole-1-carboxylate |
| SMILES | O=C(OCc1ccc(OP(=O)(OCc2ccccc2)OCc2ccccc2)c(F)c1)N1C=CCC1 |
| InChI | InChI=1S/C26H25FNO6P/c27-24-17-23(18-31-26(29)28-15-7-8-16-28)13-14-25(24)34-35(30,32-19-21-9-3-1-4-10-21)33-20-22-11-5-2-6-12-22/h1-7,9-15,17H,8,16,18-20H2 |
| InChIKey | MCZLRQIFQOSECD-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|