C12H12N4O3S2 — CID 139548248
(6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate (PubChem CID 139548248) has the molecular formula C12H12N4O3S2 and a molecular weight of 324.39 g/mol. Its IUPAC name is (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate.
| Compound Name | (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate |
|---|---|
| PubChem CID | 139548248 |
| Molecular Formula | C12H12N4O3S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate |
| SMILES | CC(C)c1csc(CS(=O)(=O)Oc2ccc(C#N)nn2)n1 |
| InChI | InChI=1S/C12H12N4O3S2/c1-8(2)10-6-20-12(14-10)7-21(17,18)19-11-4-3-9(5-13)15-16-11/h3-4,6,8H,7H2,1-2H3 |
| InChIKey | NWMCMEPEGLGQIU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 105.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|