About (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane
(6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane (PubChem CID 164538281) has the molecular formula C14H18N4O3S2
and a molecular weight of 354.46 g/mol. Its IUPAC name is (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane.
Molecular Properties
| Compound Name | (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane |
| PubChem CID | 164538281 |
| Molecular Formula | C14H18N4O3S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane |
| SMILES | CC.CC(C)c1csc(CS(=O)(=O)Oc2ccc(C#N)nn2)n1 |
| InChI | InChI=1S/C12H12N4O3S2.C2H6/c1-8(2)10-6-20-12(14-10)7-21(17,18)19-11-4-3-9(5-13)15-16-11;1-2/h3-4,6,8H,7H2,1-2H3;1-2H3 |
| InChIKey | NSYZXEQPZRUQIU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 105.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane?
The IUPAC name of (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane (CID 164538281) is (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane.
What is the SMILES notation for (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane?
The canonical SMILES for (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane is CC.CC(C)c1csc(CS(=O)(=O)Oc2ccc(C#N)nn2)n1.
What is the InChIKey of (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane?
The InChIKey is NSYZXEQPZRUQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O3S2.C2H6/c1-8(2)10-6-20-12(14-10)7-21(17,18)19-11-4-3-9(5-13)15-16-11;1-2/h3-4,6,8H,7H2,1-2H3;1-2H3.
What are the key properties of (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane?
(6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane has a molecular weight of 354.46 g/mol, XLogP of 2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyanopyridazin-3-yl) (4-propan-2-yl-1,3-thiazol-2-yl)methanesulfonate;ethane is sourced from PubChem (CID 164538281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).