C33H49N5 — CID 139558913
2-[(1R,2R,5S,8R,9R,10R,13R,14R,19R)-5-amino-1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-17-yl]pyrimidine-5-carbonitrile (PubChem CID 139558913) has the molecular formula C33H49N5 and a molecular weight of 515.79 g/mol. Its IUPAC name is 2-[(1R,2R,5S,8R,9R,10R,13R,14R,19R)-5-amino-1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-17-yl]pyrimidine-5-carbonitrile.
| Compound Name | 2-[(1R,2R,5S,8R,9R,10R,13R,14R,19R)-5-amino-1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-17-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 139558913 |
| Molecular Formula | C33H49N5 |
| Molecular Weight | 515.79 g/mol |
| Exact Mass | 515.40 |
| IUPAC Name | 2-[(1R,2R,5S,8R,9R,10R,13R,14R,19R)-5-amino-1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-17-yl]pyrimidine-5-carbonitrile |
| SMILES | C=C(C)[C@@H]1CC[C@]2(N)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CCN(c6ncc(C#N)cn6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C33H49N5/c1-21(2)23-10-13-33(35)15-14-31(6)24(27(23)33)8-9-26-30(5)16-17-38(28-36-19-22(18-34)20-37-28)29(3,4)25(30)11-12-32(26,31)7/h19-20,23-27H,1,8-17,35H2,2-7H3/t23-,24+,25-,26+,27+,30-,31+,32+,33-/m0/s1 |
| InChIKey | UREDCMAWPNIVNL-RUGINJLXSA-N |
| XLogP | 6.89 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.79 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|