C16H26N4O7 — CID 139562161
5-[[4-(acetylcarbamoyl)cyclohexyl]methylamino]-2-(hydroxycarbamoylamino)-5-oxopentanoic acid (PubChem CID 139562161) has the molecular formula C16H26N4O7 and a molecular weight of 386.41 g/mol. Its IUPAC name is 5-[[4-(acetylcarbamoyl)cyclohexyl]methylamino]-2-(hydroxycarbamoylamino)-5-oxopentanoic acid.
| Compound Name | 5-[[4-(acetylcarbamoyl)cyclohexyl]methylamino]-2-(hydroxycarbamoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 139562161 |
| Molecular Formula | C16H26N4O7 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 5-[[4-(acetylcarbamoyl)cyclohexyl]methylamino]-2-(hydroxycarbamoylamino)-5-oxopentanoic acid |
| SMILES | CC(=O)NC(=O)C1CCC(CNC(=O)CCC(NC(=O)NO)C(=O)O)CC1 |
| InChI | InChI=1S/C16H26N4O7/c1-9(21)18-14(23)11-4-2-10(3-5-11)8-17-13(22)7-6-12(15(24)25)19-16(26)20-27/h10-12,27H,2-8H2,1H3,(H,17,22)(H,24,25)(H,18,21,23)(H2,19,20,26) |
| InChIKey | UOXPCZZIGYJHRY-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 173.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|