C27H44N4O10 — CID 161415506
2-[[1-carboxy-4-[[4-[8-(methylamino)-8-oxooctanoyl]cyclohexyl]methylamino]-4-oxobutyl]carbamoylamino]pentanedioic acid (PubChem CID 161415506) has the molecular formula C27H44N4O10 and a molecular weight of 584.67 g/mol. Its IUPAC name is 2-[[1-carboxy-4-[[4-[8-(methylamino)-8-oxooctanoyl]cyclohexyl]methylamino]-4-oxobutyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-4-[[4-[8-(methylamino)-8-oxooctanoyl]cyclohexyl]methylamino]-4-oxobutyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 161415506 |
| Molecular Formula | C27H44N4O10 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 2-[[1-carboxy-4-[[4-[8-(methylamino)-8-oxooctanoyl]cyclohexyl]methylamino]-4-oxobutyl]carbamoylamino]pentanedioic acid |
| SMILES | CNC(=O)CCCCCCC(=O)C1CCC(CNC(=O)CCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C27H44N4O10/c1-28-22(33)7-5-3-2-4-6-21(32)18-10-8-17(9-11-18)16-29-23(34)14-12-19(25(37)38)30-27(41)31-20(26(39)40)13-15-24(35)36/h17-20H,2-16H2,1H3,(H,28,33)(H,29,34)(H,35,36)(H,37,38)(H,39,40)(H2,30,31,41) |
| InChIKey | GWHKGEAZXYNLHG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 228.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|