About 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate
2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate (PubChem CID 139567606) has the molecular formula C8H10FNO4
and a molecular weight of 203.17 g/mol. Its IUPAC name is 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate.
Molecular Properties
| Compound Name | 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate |
| PubChem CID | 139567606 |
| Molecular Formula | C8H10FNO4 |
| Molecular Weight | 203.17 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate |
| SMILES | C=C(F)COC(=O)C(=O)N1CCOC1 |
| InChI | InChI=1S/C8H10FNO4/c1-6(9)4-14-8(12)7(11)10-2-3-13-5-10/h1-5H2 |
| InChIKey | FYEPZYNJBYHTHW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate?
The IUPAC name of 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate (CID 139567606) is 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate.
What is the SMILES notation for 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate?
The canonical SMILES for 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate is C=C(F)COC(=O)C(=O)N1CCOC1.
What is the InChIKey of 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate?
The InChIKey is FYEPZYNJBYHTHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO4/c1-6(9)4-14-8(12)7(11)10-2-3-13-5-10/h1-5H2.
What are the key properties of 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate?
2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate has a molecular weight of 203.17 g/mol, XLogP of -0.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroprop-2-enyl 2-(1,3-oxazolidin-3-yl)-2-oxoacetate is sourced from PubChem (CID 139567606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).