C11H20N2O5 — CID 143940358
bis[2-(1,3-oxazolidin-3-yl)ethyl] carbonate (PubChem CID 143940358) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is bis[2-(1,3-oxazolidin-3-yl)ethyl] carbonate.
| Compound Name | bis[2-(1,3-oxazolidin-3-yl)ethyl] carbonate |
|---|---|
| PubChem CID | 143940358 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | bis[2-(1,3-oxazolidin-3-yl)ethyl] carbonate |
| SMILES | O=C(OCCN1CCOC1)OCCN1CCOC1 |
| InChI | InChI=1S/C11H20N2O5/c14-11(17-7-3-12-1-5-15-9-12)18-8-4-13-2-6-16-10-13/h1-10H2 |
| InChIKey | VXKRAZOGAWHQIR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |