C15H26O3 — CID 139588324
(1R,2S,3S,5S,6R,7S,8S)-2-(hydroxymethyl)-8-methyl-5-propan-2-yltricyclo[4.4.0.02,7]decane-3,8-diol (PubChem CID 139588324) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1R,2S,3S,5S,6R,7S,8S)-2-(hydroxymethyl)-8-methyl-5-propan-2-yltricyclo[4.4.0.02,7]decane-3,8-diol.
| Compound Name | (1R,2S,3S,5S,6R,7S,8S)-2-(hydroxymethyl)-8-methyl-5-propan-2-yltricyclo[4.4.0.02,7]decane-3,8-diol |
|---|---|
| PubChem CID | 139588324 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1R,2S,3S,5S,6R,7S,8S)-2-(hydroxymethyl)-8-methyl-5-propan-2-yltricyclo[4.4.0.02,7]decane-3,8-diol |
| SMILES | CC(C)[C@@H]1C[C@H](O)[C@@]2(CO)[C@@H]3CC[C@](C)(O)[C@H]2[C@@H]31 |
| InChI | InChI=1S/C15H26O3/c1-8(2)9-6-11(17)15(7-16)10-4-5-14(3,18)13(15)12(9)10/h8-13,16-18H,4-7H2,1-3H3/t9-,10+,11-,12+,13+,14-,15+/m0/s1 |
| InChIKey | BKMHRAKVPWZPND-KUBHYLHLSA-N |
| XLogP | 1.41 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |