About 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine
5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine (PubChem CID 139599914) has the molecular formula C9H18N3O3PS
and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 139599914 |
| Molecular Formula | C9H18N3O3PS |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCNc1nnc(CP(=O)(OCC)OCC)s1 |
| InChI | InChI=1S/C9H18N3O3PS/c1-4-10-9-12-11-8(17-9)7-16(13,14-5-2)15-6-3/h4-7H2,1-3H3,(H,10,12) |
| InChIKey | FZIRBCPOAMSOIM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine (CID 139599914) is 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine is CCNc1nnc(CP(=O)(OCC)OCC)s1.
What is the InChIKey of 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine?
The InChIKey is FZIRBCPOAMSOIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N3O3PS/c1-4-10-9-12-11-8(17-9)7-16(13,14-5-2)15-6-3/h4-7H2,1-3H3,(H,10,12).
What are the key properties of 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine?
5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine has a molecular weight of 279.30 g/mol, XLogP of 2.74, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diethoxyphosphorylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 139599914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).