C21H38O2 — CID 139601382
4-dodecyl-2,3,6-trimethylcyclohexa-1,5-diene-1,4-diol (PubChem CID 139601382) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is 4-dodecyl-2,3,6-trimethylcyclohexa-1,5-diene-1,4-diol.
| Compound Name | 4-dodecyl-2,3,6-trimethylcyclohexa-1,5-diene-1,4-diol |
|---|---|
| PubChem CID | 139601382 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | 4-dodecyl-2,3,6-trimethylcyclohexa-1,5-diene-1,4-diol |
| SMILES | CCCCCCCCCCCCC1(O)C=C(C)C(O)=C(C)C1C |
| InChI | InChI=1S/C21H38O2/c1-5-6-7-8-9-10-11-12-13-14-15-21(23)16-17(2)20(22)18(3)19(21)4/h16,19,22-23H,5-15H2,1-4H3 |
| InChIKey | MFMDPRZAFNTLNS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|