C24H26F2O4 — CID 139608607
2-fluoroethyl 7-[(4-fluoro-3-phenoxyphenyl)methoxy]-6,6-dimethylhepta-2,4-dienoate (PubChem CID 139608607) has the molecular formula C24H26F2O4 and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-fluoroethyl 7-[(4-fluoro-3-phenoxyphenyl)methoxy]-6,6-dimethylhepta-2,4-dienoate.
| Compound Name | 2-fluoroethyl 7-[(4-fluoro-3-phenoxyphenyl)methoxy]-6,6-dimethylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 139608607 |
| Molecular Formula | C24H26F2O4 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-fluoroethyl 7-[(4-fluoro-3-phenoxyphenyl)methoxy]-6,6-dimethylhepta-2,4-dienoate |
| SMILES | CC(C)(C=CC=CC(=O)OCCF)COCc1ccc(F)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H26F2O4/c1-24(2,13-7-6-10-23(27)29-15-14-25)18-28-17-19-11-12-21(26)22(16-19)30-20-8-4-3-5-9-20/h3-13,16H,14-15,17-18H2,1-2H3 |
| InChIKey | MRMQXGIXIVJBHN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|