C16H20BrN — CID 139609907
1-(5-bromonaphthalen-2-yl)-2,2-dimethylbutan-1-amine (PubChem CID 139609907) has the molecular formula C16H20BrN and a molecular weight of 306.25 g/mol. Its IUPAC name is 1-(5-bromonaphthalen-2-yl)-2,2-dimethylbutan-1-amine.
| Compound Name | 1-(5-bromonaphthalen-2-yl)-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 139609907 |
| Molecular Formula | C16H20BrN |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-(5-bromonaphthalen-2-yl)-2,2-dimethylbutan-1-amine |
| SMILES | CCC(C)(C)C(N)c1ccc2c(Br)cccc2c1 |
| InChI | InChI=1S/C16H20BrN/c1-4-16(2,3)15(18)12-8-9-13-11(10-12)6-5-7-14(13)17/h5-10,15H,4,18H2,1-3H3 |
| InChIKey | FBBZRZJWKKAKCC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |