C10H20O4S2Sn — CID 139617493
[dimethyl-(2-methyl-3-sulfanylpropanoyl)oxystannyl] 2-methyl-3-sulfanylpropanoate (PubChem CID 139617493) has the molecular formula C10H20O4S2Sn and a molecular weight of 387.11 g/mol. Its IUPAC name is [dimethyl-(2-methyl-3-sulfanylpropanoyl)oxystannyl] 2-methyl-3-sulfanylpropanoate.
| Compound Name | [dimethyl-(2-methyl-3-sulfanylpropanoyl)oxystannyl] 2-methyl-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 139617493 |
| Molecular Formula | C10H20O4S2Sn |
| Molecular Weight | 387.11 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | [dimethyl-(2-methyl-3-sulfanylpropanoyl)oxystannyl] 2-methyl-3-sulfanylpropanoate |
| SMILES | CC(CS)C(=O)O[Sn](C)(C)OC(=O)C(C)CS |
| InChI | InChI=1S/2C4H8O2S.2CH3.Sn/c2*1-3(2-7)4(5)6;;;/h2*3,7H,2H2,1H3,(H,5,6);2*1H3;/q;;;;+2/p-2 |
| InChIKey | JPLYYEIOHUCWPI-UHFFFAOYSA-L |
| XLogP | 1.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.11 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|