C17H16ClNO6 — CID 139619241
(5-chloro-1,3-dioxoisoindol-2-yl) 6-prop-2-enoyloxyhexanoate (PubChem CID 139619241) has the molecular formula C17H16ClNO6 and a molecular weight of 365.77 g/mol. Its IUPAC name is (5-chloro-1,3-dioxoisoindol-2-yl) 6-prop-2-enoyloxyhexanoate.
| Compound Name | (5-chloro-1,3-dioxoisoindol-2-yl) 6-prop-2-enoyloxyhexanoate |
|---|---|
| PubChem CID | 139619241 |
| Molecular Formula | C17H16ClNO6 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (5-chloro-1,3-dioxoisoindol-2-yl) 6-prop-2-enoyloxyhexanoate |
| SMILES | C=CC(=O)OCCCCCC(=O)ON1C(=O)c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C17H16ClNO6/c1-2-14(20)24-9-5-3-4-6-15(21)25-19-16(22)12-8-7-11(18)10-13(12)17(19)23/h2,7-8,10H,1,3-6,9H2 |
| InChIKey | OZKITXAPOLEULD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|