C16H24 — CID 139619738
3,4,5,8-tetramethyltetracyclo[6.2.1.13,6.02,7]dodec-1-ene (PubChem CID 139619738) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 3,4,5,8-tetramethyltetracyclo[6.2.1.13,6.02,7]dodec-1-ene.
| Compound Name | 3,4,5,8-tetramethyltetracyclo[6.2.1.13,6.02,7]dodec-1-ene |
|---|---|
| PubChem CID | 139619738 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 3,4,5,8-tetramethyltetracyclo[6.2.1.13,6.02,7]dodec-1-ene |
| SMILES | CC1C2CC(C)(C3=C4CCC(C)(C4)C32)C1C |
| InChI | InChI=1S/C16H24/c1-9-10(2)16(4)8-12(9)14-13(16)11-5-6-15(14,3)7-11/h9-10,12,14H,5-8H2,1-4H3 |
| InChIKey | TWECQPLAKBWONN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|