About 2-iodoethenyl nitrate
2-iodoethenyl nitrate (PubChem CID 139620012) has the molecular formula C2H2INO3
and a molecular weight of 214.95 g/mol. Its IUPAC name is 2-iodoethenyl nitrate.
Molecular Properties
| Compound Name | 2-iodoethenyl nitrate |
| PubChem CID | 139620012 |
| Molecular Formula | C2H2INO3 |
| Molecular Weight | 214.95 g/mol |
| Exact Mass | 214.91 |
| IUPAC Name | 2-iodoethenyl nitrate |
| SMILES | O=[N+]([O-])OC=CI |
| InChI | InChI=1S/C2H2INO3/c3-1-2-7-4(5)6/h1-2H |
| InChIKey | GRDUKOMSOHVTRU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.95 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-iodoethenyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodoethenyl nitrate?
The IUPAC name of 2-iodoethenyl nitrate (CID 139620012) is 2-iodoethenyl nitrate.
What is the SMILES notation for 2-iodoethenyl nitrate?
The canonical SMILES for 2-iodoethenyl nitrate is O=[N+]([O-])OC=CI.
What is the InChIKey of 2-iodoethenyl nitrate?
The InChIKey is GRDUKOMSOHVTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2INO3/c3-1-2-7-4(5)6/h1-2H.
What are the key properties of 2-iodoethenyl nitrate?
2-iodoethenyl nitrate has a molecular weight of 214.95 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodoethenyl nitrate is sourced from PubChem (CID 139620012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).