C35H31FO4 — CID 139620321
methyl 3-[2-[4-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]but-1-enyl]phenyl]prop-2-ynoate (PubChem CID 139620321) has the molecular formula C35H31FO4 and a molecular weight of 534.63 g/mol. Its IUPAC name is methyl 3-[2-[4-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]but-1-enyl]phenyl]prop-2-ynoate.
| Compound Name | methyl 3-[2-[4-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]but-1-enyl]phenyl]prop-2-ynoate |
|---|---|
| PubChem CID | 139620321 |
| Molecular Formula | C35H31FO4 |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | methyl 3-[2-[4-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]but-1-enyl]phenyl]prop-2-ynoate |
| SMILES | CCc1cc(-c2ccc(F)cc2)c(OCc2ccccc2)cc1OCCC=Cc1ccccc1C#CC(=O)OC |
| InChI | InChI=1S/C35H31FO4/c1-3-27-23-32(30-16-19-31(36)20-17-30)34(40-25-26-11-5-4-6-12-26)24-33(27)39-22-10-9-15-28-13-7-8-14-29(28)18-21-35(37)38-2/h4-9,11-17,19-20,23-24H,3,10,22,25H2,1-2H3 |
| InChIKey | MXWAVGZLXFMNDP-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|