C22H22N4O2S — CID 139620429
3-amino-N',N'-dimethyl-4-(1-phenylindol-2-yl)benzenesulfonohydrazide (PubChem CID 139620429) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-amino-N',N'-dimethyl-4-(1-phenylindol-2-yl)benzenesulfonohydrazide.
| Compound Name | 3-amino-N',N'-dimethyl-4-(1-phenylindol-2-yl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 139620429 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-amino-N',N'-dimethyl-4-(1-phenylindol-2-yl)benzenesulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1ccc(-c2cc3ccccc3n2-c2ccccc2)c(N)c1 |
| InChI | InChI=1S/C22H22N4O2S/c1-25(2)24-29(27,28)18-12-13-19(20(23)15-18)22-14-16-8-6-7-11-21(16)26(22)17-9-4-3-5-10-17/h3-15,24H,23H2,1-2H3 |
| InChIKey | OJKQYFMEZOVFJD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|