About bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate
bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate (PubChem CID 139626180) has the molecular formula C22H26O9
and a molecular weight of 434.44 g/mol. Its IUPAC name is bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate |
| PubChem CID | 139626180 |
| Molecular Formula | C22H26O9 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OC(C)OC(=O)c1cccc(CCO)c1C(=O)OC(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C22H26O9/c1-12(2)19(24)28-14(5)30-21(26)17-9-7-8-16(10-11-23)18(17)22(27)31-15(6)29-20(25)13(3)4/h7-9,14-15,23H,1,3,10-11H2,2,4-6H3 |
| InChIKey | GHJOQBNNUWEWKO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate?
The IUPAC name of bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate (CID 139626180) is bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate.
What is the SMILES notation for bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate?
The canonical SMILES for bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate is C=C(C)C(=O)OC(C)OC(=O)c1cccc(CCO)c1C(=O)OC(C)OC(=O)C(=C)C.
What is the InChIKey of bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate?
The InChIKey is GHJOQBNNUWEWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O9/c1-12(2)19(24)28-14(5)30-21(26)17-9-7-8-16(10-11-23)18(17)22(27)31-15(6)29-20(25)13(3)4/h7-9,14-15,23H,1,3,10-11H2,2,4-6H3.
What are the key properties of bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate?
bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate has a molecular weight of 434.44 g/mol, XLogP of 2.47, 10 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis[1-(2-methylprop-2-enoyloxy)ethyl] 3-(2-hydroxyethyl)benzene-1,2-dicarboxylate is sourced from PubChem (CID 139626180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).