C17H20O8 — CID 139628999
bis(1-hydroxyethyl) 4-(2-hydroxyethyl)-3-prop-2-enoylbenzene-1,2-dicarboxylate (PubChem CID 139628999) has the molecular formula C17H20O8 and a molecular weight of 352.34 g/mol. Its IUPAC name is bis(1-hydroxyethyl) 4-(2-hydroxyethyl)-3-prop-2-enoylbenzene-1,2-dicarboxylate.
| Compound Name | bis(1-hydroxyethyl) 4-(2-hydroxyethyl)-3-prop-2-enoylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139628999 |
| Molecular Formula | C17H20O8 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | bis(1-hydroxyethyl) 4-(2-hydroxyethyl)-3-prop-2-enoylbenzene-1,2-dicarboxylate |
| SMILES | C=CC(=O)c1c(CCO)ccc(C(=O)OC(C)O)c1C(=O)OC(C)O |
| InChI | InChI=1S/C17H20O8/c1-4-13(21)14-11(7-8-18)5-6-12(16(22)24-9(2)19)15(14)17(23)25-10(3)20/h4-6,9-10,18-20H,1,7-8H2,2-3H3 |
| InChIKey | JWCQHROVOAOYQP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|