C26H28Cl4N2O4 — CID 139626994
4-[3-(4-amino-2,6-dichlorophenoxy)-2,5-dibutoxyphenoxy]-3,5-dichloroaniline (PubChem CID 139626994) has the molecular formula C26H28Cl4N2O4 and a molecular weight of 574.33 g/mol. Its IUPAC name is 4-[3-(4-amino-2,6-dichlorophenoxy)-2,5-dibutoxyphenoxy]-3,5-dichloroaniline.
| Compound Name | 4-[3-(4-amino-2,6-dichlorophenoxy)-2,5-dibutoxyphenoxy]-3,5-dichloroaniline |
|---|---|
| PubChem CID | 139626994 |
| Molecular Formula | C26H28Cl4N2O4 |
| Molecular Weight | 574.33 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | 4-[3-(4-amino-2,6-dichlorophenoxy)-2,5-dibutoxyphenoxy]-3,5-dichloroaniline |
| SMILES | CCCCOc1cc(Oc2c(Cl)cc(N)cc2Cl)c(OCCCC)c(Oc2c(Cl)cc(N)cc2Cl)c1 |
| InChI | InChI=1S/C26H28Cl4N2O4/c1-3-5-7-33-17-13-22(35-24-18(27)9-15(31)10-19(24)28)26(34-8-6-4-2)23(14-17)36-25-20(29)11-16(32)12-21(25)30/h9-14H,3-8,31-32H2,1-2H3 |
| InChIKey | VNKHRFKJOBWUQJ-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.33 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|