C18H27ClO4S — CID 139629569
4-[3-(3-chloropropylsulfanyl)-6-(1-hydroxyethyl)-2-propylphenoxy]butanoic acid (PubChem CID 139629569) has the molecular formula C18H27ClO4S and a molecular weight of 374.93 g/mol. Its IUPAC name is 4-[3-(3-chloropropylsulfanyl)-6-(1-hydroxyethyl)-2-propylphenoxy]butanoic acid.
| Compound Name | 4-[3-(3-chloropropylsulfanyl)-6-(1-hydroxyethyl)-2-propylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 139629569 |
| Molecular Formula | C18H27ClO4S |
| Molecular Weight | 374.93 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-[3-(3-chloropropylsulfanyl)-6-(1-hydroxyethyl)-2-propylphenoxy]butanoic acid |
| SMILES | CCCc1c(SCCCCl)ccc(C(C)O)c1OCCCC(=O)O |
| InChI | InChI=1S/C18H27ClO4S/c1-3-6-15-16(24-12-5-10-19)9-8-14(13(2)20)18(15)23-11-4-7-17(21)22/h8-9,13,20H,3-7,10-12H2,1-2H3,(H,21,22) |
| InChIKey | OQCXZLWLLPFHCH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.93 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|