C20H31ClO5 — CID 67807804
4-[3-(3-chloropropoxy)-6-(1-hydroxyethyl)-2-propylphenoxy]-2-ethylbutanoic acid (PubChem CID 67807804) has the molecular formula C20H31ClO5 and a molecular weight of 386.92 g/mol. Its IUPAC name is 4-[3-(3-chloropropoxy)-6-(1-hydroxyethyl)-2-propylphenoxy]-2-ethylbutanoic acid.
| Compound Name | 4-[3-(3-chloropropoxy)-6-(1-hydroxyethyl)-2-propylphenoxy]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 67807804 |
| Molecular Formula | C20H31ClO5 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-[3-(3-chloropropoxy)-6-(1-hydroxyethyl)-2-propylphenoxy]-2-ethylbutanoic acid |
| SMILES | CCCc1c(OCCCCl)ccc(C(C)O)c1OCCC(CC)C(=O)O |
| InChI | InChI=1S/C20H31ClO5/c1-4-7-17-18(25-12-6-11-21)9-8-16(14(3)22)19(17)26-13-10-15(5-2)20(23)24/h8-9,14-15,22H,4-7,10-13H2,1-3H3,(H,23,24) |
| InChIKey | KPBFZUYDDLLHRO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|