C28H40O6S — CID 126669637
4-[6-(1-hydroxyethyl)-3-[3-(3-hydroxy-4-methyl-2-propylphenyl)sulfanylpropoxy]-2-propylphenoxy]butanoic acid (PubChem CID 126669637) has the molecular formula C28H40O6S and a molecular weight of 504.69 g/mol. Its IUPAC name is 4-[6-(1-hydroxyethyl)-3-[3-(3-hydroxy-4-methyl-2-propylphenyl)sulfanylpropoxy]-2-propylphenoxy]butanoic acid.
| Compound Name | 4-[6-(1-hydroxyethyl)-3-[3-(3-hydroxy-4-methyl-2-propylphenyl)sulfanylpropoxy]-2-propylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 126669637 |
| Molecular Formula | C28H40O6S |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 4-[6-(1-hydroxyethyl)-3-[3-(3-hydroxy-4-methyl-2-propylphenyl)sulfanylpropoxy]-2-propylphenoxy]butanoic acid |
| SMILES | CCCc1c(SCCCOc2ccc(C(C)O)c(OCCCC(=O)O)c2CCC)ccc(C)c1O |
| InChI | InChI=1S/C28H40O6S/c1-5-9-22-24(14-13-21(20(4)29)28(22)34-16-7-11-26(30)31)33-17-8-18-35-25-15-12-19(3)27(32)23(25)10-6-2/h12-15,20,29,32H,5-11,16-18H2,1-4H3,(H,30,31) |
| InChIKey | WVZYBUYESVKJJI-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|