C12H11N3O2 — CID 139630245
5-(3-methyl-1H-indol-2-yl)imidazolidine-2,4-dione (PubChem CID 139630245) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 5-(3-methyl-1H-indol-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-(3-methyl-1H-indol-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139630245 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 5-(3-methyl-1H-indol-2-yl)imidazolidine-2,4-dione |
| SMILES | Cc1c(C2NC(=O)NC2=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C12H11N3O2/c1-6-7-4-2-3-5-8(7)13-9(6)10-11(16)15-12(17)14-10/h2-5,10,13H,1H3,(H2,14,15,16,17) |
| InChIKey | ZQYKFWFCTMOOBP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|