C18H32BrNO5Si — CID 139631663
(4S,5R,6S)-3-bromo-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethoxy-4-methyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 139631663) has the molecular formula C18H32BrNO5Si and a molecular weight of 450.45 g/mol. Its IUPAC name is (4S,5R,6S)-3-bromo-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethoxy-4-methyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (4S,5R,6S)-3-bromo-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethoxy-4-methyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 139631663 |
| Molecular Formula | C18H32BrNO5Si |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (4S,5R,6S)-3-bromo-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethoxy-4-methyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CCOC1(C(=O)O)C(Br)[C@@H](C)[C@H]2[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N21 |
| InChI | InChI=1S/C18H32BrNO5Si/c1-9-24-18(16(22)23)14(19)10(2)13-12(15(21)20(13)18)11(3)25-26(7,8)17(4,5)6/h10-14H,9H2,1-8H3,(H,22,23)/t10-,11+,12+,13-,14?,18?/m0/s1 |
| InChIKey | ACNNMRUBMJFIJB-DOFHUEEBSA-N |
| XLogP | 3.45 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|