C17H18N8O5S3 — CID 139636896
(6R,7S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethylsulfanyl)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 139636896) has the molecular formula C17H18N8O5S3 and a molecular weight of 510.58 g/mol. Its IUPAC name is (6R,7S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethylsulfanyl)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethylsulfanyl)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 139636896 |
| Molecular Formula | C17H18N8O5S3 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | (6R,7S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2H-triazol-4-ylsulfanylmethylsulfanyl)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(SCSc3cn[nH]n3)CC[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C17H18N8O5S3/c1-30-23-11(7-5-31-17(18)20-7)14(26)21-12-8-2-3-9(13(16(28)29)25(8)15(12)27)32-6-33-10-4-19-24-22-10/h4-5,8,12H,2-3,6H2,1H3,(H2,18,20)(H,21,26)(H,28,29)(H,19,22,24)/t8-,12+/m1/s1 |
| InChIKey | QSHYIWVSJZYEDS-PELKAZGASA-N |
| XLogP | 0.46 |
| TPSA | 188.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|