C30H44O6S — CID 139637454
methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate (PubChem CID 139637454) has the molecular formula C30H44O6S and a molecular weight of 532.74 g/mol. Its IUPAC name is methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate.
| Compound Name | methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate |
|---|---|
| PubChem CID | 139637454 |
| Molecular Formula | C30H44O6S |
| Molecular Weight | 532.74 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate |
| SMILES | CCCCC(C)C[C@H](O)/C=C/[C@H]1[C@H]2CC(C(CCCC(=O)OC)S(=O)(=O)c3ccccc3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C30H44O6S/c1-4-5-10-21(2)17-24(31)15-16-26-27-19-23(18-22(27)20-28(26)32)29(13-9-14-30(33)36-3)37(34,35)25-11-7-6-8-12-25/h6-8,11-12,15-16,18,21-22,24,26-29,31-32H,4-5,9-10,13-14,17,19-20H2,1-3H3/b16-15+/t21?,22-,24+,26-,27-,28+,29?/m0/s1 |
| InChIKey | QFJQFBGYONTRBY-PZMLNJELSA-N |
| XLogP | 5.25 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.74 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|