C29H42O6S — CID 139637455
methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate (PubChem CID 139637455) has the molecular formula C29H42O6S and a molecular weight of 518.72 g/mol. Its IUPAC name is methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate.
| Compound Name | methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate |
|---|---|
| PubChem CID | 139637455 |
| Molecular Formula | C29H42O6S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | methyl 5-[(3aS,5R,6S,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-5-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-5-(benzenesulfonyl)pentanoate |
| SMILES | CCCC(C)C[C@H](O)/C=C/[C@H]1[C@H]2CC(C(CCCC(=O)OC)S(=O)(=O)c3ccccc3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C29H42O6S/c1-4-9-20(2)16-23(30)14-15-25-26-18-22(17-21(26)19-27(25)31)28(12-8-13-29(32)35-3)36(33,34)24-10-6-5-7-11-24/h5-7,10-11,14-15,17,20-21,23,25-28,30-31H,4,8-9,12-13,16,18-19H2,1-3H3/b15-14+/t20?,21-,23+,25-,26-,27+,28?/m0/s1 |
| InChIKey | PLRBSSOPQWPCCQ-HEIFGLBQSA-N |
| XLogP | 4.86 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|