C24H34O4S — CID 139637464
(2R,3S,3aS,6aS)-6-(benzenesulfonylmethyl)-3-[(E,3S)-3-hydroxynon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 139637464) has the molecular formula C24H34O4S and a molecular weight of 418.60 g/mol. Its IUPAC name is (2R,3S,3aS,6aS)-6-(benzenesulfonylmethyl)-3-[(E,3S)-3-hydroxynon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3S,3aS,6aS)-6-(benzenesulfonylmethyl)-3-[(E,3S)-3-hydroxynon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 139637464 |
| Molecular Formula | C24H34O4S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (2R,3S,3aS,6aS)-6-(benzenesulfonylmethyl)-3-[(E,3S)-3-hydroxynon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCCCC[C@H](O)/C=C/[C@H]1[C@H]2CC=C(CS(=O)(=O)c3ccccc3)[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H34O4S/c1-2-3-4-6-9-19(25)13-15-22-21-14-12-18(23(21)16-24(22)26)17-29(27,28)20-10-7-5-8-11-20/h5,7-8,10-13,15,19,21-26H,2-4,6,9,14,16-17H2,1H3/b15-13+/t19-,21+,22-,23+,24+/m0/s1 |
| InChIKey | GAJIOLGSDZVROT-PAXYETRSSA-N |
| XLogP | 4.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|