C16H22O3S — CID 134979319
(1S)-1-[(1S,2S)-2-(benzenesulfonyl)-2-ethenylcyclopentyl]propan-1-ol (PubChem CID 134979319) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is (1S)-1-[(1S,2S)-2-(benzenesulfonyl)-2-ethenylcyclopentyl]propan-1-ol.
| Compound Name | (1S)-1-[(1S,2S)-2-(benzenesulfonyl)-2-ethenylcyclopentyl]propan-1-ol |
|---|---|
| PubChem CID | 134979319 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (1S)-1-[(1S,2S)-2-(benzenesulfonyl)-2-ethenylcyclopentyl]propan-1-ol |
| SMILES | C=C[C@@]1(S(=O)(=O)c2ccccc2)CCC[C@H]1[C@@H](O)CC |
| InChI | InChI=1S/C16H22O3S/c1-3-15(17)14-11-8-12-16(14,4-2)20(18,19)13-9-6-5-7-10-13/h4-7,9-10,14-15,17H,2-3,8,11-12H2,1H3/t14-,15-,16+/m0/s1 |
| InChIKey | SNIHDFGBOQXDML-HRCADAONSA-N |
| XLogP | 2.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|