(1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate

C14H10O5 — CID 139638022

IUPAC(1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate
SMILESCC#COc1ccc2c(c1)C(=O)C(OC(C)=O)C2=O
InChIInChI=1S/C14H10O5/c1-3-6-18-9-4-5-10-11(7-9)13(17)14(12(10)16)19-8(2)15/h4-5,7,14H,1-2H3
InChIKeyWDYBFCODSFPDBH-UHFFFAOYSA-N
MW258.23 g/mol
LogP1.36
Rot. Bonds2

About (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate

(1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate (PubChem CID 139638022) has the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. Its IUPAC name is (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate.

Molecular Properties

Compound Name(1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate
PubChem CID139638022
Molecular FormulaC14H10O5
Molecular Weight258.23 g/mol
Exact Mass258.05
IUPAC Name(1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate
SMILESCC#COc1ccc2c(c1)C(=O)C(OC(C)=O)C2=O
InChIInChI=1S/C14H10O5/c1-3-6-18-9-4-5-10-11(7-9)13(17)14(12(10)16)19-8(2)15/h4-5,7,14H,1-2H3
InChIKeyWDYBFCODSFPDBH-UHFFFAOYSA-N
XLogP1.36
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.23
LogP ≤ 51.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate?
The IUPAC name of (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate (CID 139638022) is (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate.
What is the SMILES notation for (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate?
The canonical SMILES for (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate is CC#COc1ccc2c(c1)C(=O)C(OC(C)=O)C2=O.
What is the InChIKey of (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate?
The InChIKey is WDYBFCODSFPDBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O5/c1-3-6-18-9-4-5-10-11(7-9)13(17)14(12(10)16)19-8(2)15/h4-5,7,14H,1-2H3.
What are the key properties of (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate?
(1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate has a molecular weight of 258.23 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate is sourced from PubChem (CID 139638022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).