C14H10O5 — CID 139638022
(1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate (PubChem CID 139638022) has the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. Its IUPAC name is (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate.
| Compound Name | (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate |
|---|---|
| PubChem CID | 139638022 |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) acetate |
| SMILES | CC#COc1ccc2c(c1)C(=O)C(OC(C)=O)C2=O |
| InChI | InChI=1S/C14H10O5/c1-3-6-18-9-4-5-10-11(7-9)13(17)14(12(10)16)19-8(2)15/h4-5,7,14H,1-2H3 |
| InChIKey | WDYBFCODSFPDBH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|