C13H8O5 — CID 139638075
(1,3-dioxo-5-prop-1-ynoxyinden-2-yl) formate (PubChem CID 139638075) has the molecular formula C13H8O5 and a molecular weight of 244.20 g/mol. Its IUPAC name is (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) formate.
| Compound Name | (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) formate |
|---|---|
| PubChem CID | 139638075 |
| Molecular Formula | C13H8O5 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | (1,3-dioxo-5-prop-1-ynoxyinden-2-yl) formate |
| SMILES | CC#COc1ccc2c(c1)C(=O)C(OC=O)C2=O |
| InChI | InChI=1S/C13H8O5/c1-2-5-17-8-3-4-9-10(6-8)12(16)13(11(9)15)18-7-14/h3-4,6-7,13H,1H3 |
| InChIKey | YUPPTRNASHXKHA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|