C20H8N2O5 — CID 177259700
5-(2-cyano-1,3-dioxoinden-5-yl)oxy-1,3-dioxoindene-2-carbonitrile (PubChem CID 177259700) has the molecular formula C20H8N2O5 and a molecular weight of 356.29 g/mol. Its IUPAC name is 5-(2-cyano-1,3-dioxoinden-5-yl)oxy-1,3-dioxoindene-2-carbonitrile.
| Compound Name | 5-(2-cyano-1,3-dioxoinden-5-yl)oxy-1,3-dioxoindene-2-carbonitrile |
|---|---|
| PubChem CID | 177259700 |
| Molecular Formula | C20H8N2O5 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 5-(2-cyano-1,3-dioxoinden-5-yl)oxy-1,3-dioxoindene-2-carbonitrile |
| SMILES | N#CC1C(=O)c2ccc(Oc3ccc4c(c3)C(=O)C(C#N)C4=O)cc2C1=O |
| InChI | InChI=1S/C20H8N2O5/c21-7-15-17(23)11-3-1-9(5-13(11)19(15)25)27-10-2-4-12-14(6-10)20(26)16(8-22)18(12)24/h1-6,15-16H |
| InChIKey | NDWRZMXAGNSLQH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 125.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|