C26H20N2O7 — CID 163236912
N-cyclopropyl-5-[2-(cyclopropylcarbamoyl)-1,3-dioxoinden-5-yl]oxy-1,3-dioxoindene-2-carboxamide (PubChem CID 163236912) has the molecular formula C26H20N2O7 and a molecular weight of 472.45 g/mol. Its IUPAC name is N-cyclopropyl-5-[2-(cyclopropylcarbamoyl)-1,3-dioxoinden-5-yl]oxy-1,3-dioxoindene-2-carboxamide.
| Compound Name | N-cyclopropyl-5-[2-(cyclopropylcarbamoyl)-1,3-dioxoinden-5-yl]oxy-1,3-dioxoindene-2-carboxamide |
|---|---|
| PubChem CID | 163236912 |
| Molecular Formula | C26H20N2O7 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-cyclopropyl-5-[2-(cyclopropylcarbamoyl)-1,3-dioxoinden-5-yl]oxy-1,3-dioxoindene-2-carboxamide |
| SMILES | O=C(NC1CC1)C1C(=O)c2ccc(Oc3ccc4c(c3)C(=O)C(C(=O)NC3CC3)C4=O)cc2C1=O |
| InChI | InChI=1S/C26H20N2O7/c29-21-15-7-5-13(9-17(15)23(31)19(21)25(33)27-11-1-2-11)35-14-6-8-16-18(10-14)24(32)20(22(16)30)26(34)28-12-3-4-12/h5-12,19-20H,1-4H2,(H,27,33)(H,28,34) |
| InChIKey | IIRLJFYXWXLJAK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|