C31H28N2O7 — CID 177259696
N-cyclopentyl-5-[2-(cyclopentylcarbamoyl)-1,3-dioxoindene-5-carbonyl]-1,3-dioxoindene-2-carboxamide (PubChem CID 177259696) has the molecular formula C31H28N2O7 and a molecular weight of 540.57 g/mol. Its IUPAC name is N-cyclopentyl-5-[2-(cyclopentylcarbamoyl)-1,3-dioxoindene-5-carbonyl]-1,3-dioxoindene-2-carboxamide.
| Compound Name | N-cyclopentyl-5-[2-(cyclopentylcarbamoyl)-1,3-dioxoindene-5-carbonyl]-1,3-dioxoindene-2-carboxamide |
|---|---|
| PubChem CID | 177259696 |
| Molecular Formula | C31H28N2O7 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | N-cyclopentyl-5-[2-(cyclopentylcarbamoyl)-1,3-dioxoindene-5-carbonyl]-1,3-dioxoindene-2-carboxamide |
| SMILES | O=C(c1ccc2c(c1)C(=O)C(C(=O)NC1CCCC1)C2=O)c1ccc2c(c1)C(=O)C(C(=O)NC1CCCC1)C2=O |
| InChI | InChI=1S/C31H28N2O7/c34-25(15-9-11-19-21(13-15)28(37)23(26(19)35)30(39)32-17-5-1-2-6-17)16-10-12-20-22(14-16)29(38)24(27(20)36)31(40)33-18-7-3-4-8-18/h9-14,17-18,23-24H,1-8H2,(H,32,39)(H,33,40) |
| InChIKey | FWVAUYKGXXRHRZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|